C21H23BrN2O2 — CID 100698638
2-[[2-(3-bromophenyl)acetyl]amino]-N-cyclohexylbenzamide (PubChem CID 100698638) has the molecular formula C21H23BrN2O2 and a molecular weight of 415.33 g/mol. Its IUPAC name is 2-[[2-(3-bromophenyl)acetyl]amino]-N-cyclohexylbenzamide.
| Compound Name | 2-[[2-(3-bromophenyl)acetyl]amino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 100698638 |
| Molecular Formula | C21H23BrN2O2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[[2-(3-bromophenyl)acetyl]amino]-N-cyclohexylbenzamide |
| SMILES | O=C(Cc1cccc(Br)c1)Nc1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H23BrN2O2/c22-16-8-6-7-15(13-16)14-20(25)24-19-12-5-4-11-18(19)21(26)23-17-9-2-1-3-10-17/h4-8,11-13,17H,1-3,9-10,14H2,(H,23,26)(H,24,25) |
| InChIKey | OVVUKWJAQVQSNH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |