C18H24N2O2 — CID 34280929
2-[(2-cyclohexylacetyl)amino]-N-cyclopropylbenzamide (PubChem CID 34280929) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[(2-cyclohexylacetyl)amino]-N-cyclopropylbenzamide.
| Compound Name | 2-[(2-cyclohexylacetyl)amino]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 34280929 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-[(2-cyclohexylacetyl)amino]-N-cyclopropylbenzamide |
| SMILES | O=C(CC1CCCCC1)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C18H24N2O2/c21-17(12-13-6-2-1-3-7-13)20-16-9-5-4-8-15(16)18(22)19-14-10-11-14/h4-5,8-9,13-14H,1-3,6-7,10-12H2,(H,19,22)(H,20,21) |
| InChIKey | HXWKOJZDENZFAI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |