C20H28N4O3 — CID 9053688
N-cyclopentyl-2-[[2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]acetyl]amino]benzamide (PubChem CID 9053688) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]acetyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 9053688 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-cyclopentyl-2-[[2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]acetyl]amino]benzamide |
| SMILES | CN(CC(=O)Nc1ccccc1C(=O)NC1CCCC1)CC(=O)NC1CC1 |
| InChI | InChI=1S/C20H28N4O3/c1-24(12-18(25)21-15-10-11-15)13-19(26)23-17-9-5-4-8-16(17)20(27)22-14-6-2-3-7-14/h4-5,8-9,14-15H,2-3,6-7,10-13H2,1H3,(H,21,25)(H,22,27)(H,23,26) |
| InChIKey | IBSYARBZVGLGBH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |