C20H30N4O3 — CID 9050106
N-cyclopentyl-2-[[2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetyl]amino]benzamide (PubChem CID 9050106) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 9050106 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-cyclopentyl-2-[[2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetyl]amino]benzamide |
| SMILES | CC(C)NC(=O)CN(C)CC(=O)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H30N4O3/c1-14(2)21-18(25)12-24(3)13-19(26)23-17-11-7-6-10-16(17)20(27)22-15-8-4-5-9-15/h6-7,10-11,14-15H,4-5,8-9,12-13H2,1-3H3,(H,21,25)(H,22,27)(H,23,26) |
| InChIKey | UOIYJFYNUAVQCD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |