C14H18IN3O2 — CID 9053773
N-cyclopropyl-2-[[2-(2-iodoanilino)-2-oxoethyl]-methylamino]acetamide (PubChem CID 9053773) has the molecular formula C14H18IN3O2 and a molecular weight of 387.22 g/mol. Its IUPAC name is N-cyclopropyl-2-[[2-(2-iodoanilino)-2-oxoethyl]-methylamino]acetamide.
| Compound Name | N-cyclopropyl-2-[[2-(2-iodoanilino)-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 9053773 |
| Molecular Formula | C14H18IN3O2 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | N-cyclopropyl-2-[[2-(2-iodoanilino)-2-oxoethyl]-methylamino]acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1I)CC(=O)NC1CC1 |
| InChI | InChI=1S/C14H18IN3O2/c1-18(8-13(19)16-10-6-7-10)9-14(20)17-12-5-3-2-4-11(12)15/h2-5,10H,6-9H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | GZRCSGAVTQRLNG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|