C20H21F2N3O2 — CID 33162764
N-cyclopentyl-2-[[2-(2,5-difluoroanilino)acetyl]amino]benzamide (PubChem CID 33162764) has the molecular formula C20H21F2N3O2 and a molecular weight of 373.40 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-(2,5-difluoroanilino)acetyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[2-(2,5-difluoroanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 33162764 |
| Molecular Formula | C20H21F2N3O2 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-cyclopentyl-2-[[2-(2,5-difluoroanilino)acetyl]amino]benzamide |
| SMILES | O=C(CNc1cc(F)ccc1F)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H21F2N3O2/c21-13-9-10-16(22)18(11-13)23-12-19(26)25-17-8-4-3-7-15(17)20(27)24-14-5-1-2-6-14/h3-4,7-11,14,23H,1-2,5-6,12H2,(H,24,27)(H,25,26) |
| InChIKey | LXIHNSOLFRAPRR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |