C27H28FN3O2 — CID 60537204
N-cyclopentyl-2-[[2-[[(4-fluorophenyl)-phenylmethyl]amino]acetyl]amino]benzamide (PubChem CID 60537204) has the molecular formula C27H28FN3O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-[[(4-fluorophenyl)-phenylmethyl]amino]acetyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[2-[[(4-fluorophenyl)-phenylmethyl]amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 60537204 |
| Molecular Formula | C27H28FN3O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | N-cyclopentyl-2-[[2-[[(4-fluorophenyl)-phenylmethyl]amino]acetyl]amino]benzamide |
| SMILES | O=C(CNC(c1ccccc1)c1ccc(F)cc1)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C27H28FN3O2/c28-21-16-14-20(15-17-21)26(19-8-2-1-3-9-19)29-18-25(32)31-24-13-7-6-12-23(24)27(33)30-22-10-4-5-11-22/h1-3,6-9,12-17,22,26,29H,4-5,10-11,18H2,(H,30,33)(H,31,32) |
| InChIKey | GJQGOIAHTHXDIQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |