C20H23FN2O2 — CID 96516187
2-[[(R)-(4-fluorophenyl)-phenylmethyl]amino]-N-(oxan-4-yl)acetamide (PubChem CID 96516187) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 2-[[(R)-(4-fluorophenyl)-phenylmethyl]amino]-N-(oxan-4-yl)acetamide.
| Compound Name | 2-[[(R)-(4-fluorophenyl)-phenylmethyl]amino]-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 96516187 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[[(R)-(4-fluorophenyl)-phenylmethyl]amino]-N-(oxan-4-yl)acetamide |
| SMILES | O=C(CN[C@H](c1ccccc1)c1ccc(F)cc1)NC1CCOCC1 |
| InChI | InChI=1S/C20H23FN2O2/c21-17-8-6-16(7-9-17)20(15-4-2-1-3-5-15)22-14-19(24)23-18-10-12-25-13-11-18/h1-9,18,20,22H,10-14H2,(H,23,24)/t20-/m1/s1 |
| InChIKey | QKCHEOQRNWTSJI-HXUWFJFHSA-N |
| XLogP | 2.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |