C21H18ClFN2O — CID 60537351
N-(2-chlorophenyl)-2-[[(4-fluorophenyl)-phenylmethyl]amino]acetamide (PubChem CID 60537351) has the molecular formula C21H18ClFN2O and a molecular weight of 368.84 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[[(4-fluorophenyl)-phenylmethyl]amino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[[(4-fluorophenyl)-phenylmethyl]amino]acetamide |
|---|---|
| PubChem CID | 60537351 |
| Molecular Formula | C21H18ClFN2O |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-(2-chlorophenyl)-2-[[(4-fluorophenyl)-phenylmethyl]amino]acetamide |
| SMILES | O=C(CNC(c1ccccc1)c1ccc(F)cc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H18ClFN2O/c22-18-8-4-5-9-19(18)25-20(26)14-24-21(15-6-2-1-3-7-15)16-10-12-17(23)13-11-16/h1-13,21,24H,14H2,(H,25,26) |
| InChIKey | KLGIUNUUOPEPDW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |