C21H16ClF3N2O — CID 4858348
2-[[(4-chlorophenyl)-phenylmethyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 4858348) has the molecular formula C21H16ClF3N2O and a molecular weight of 404.82 g/mol. Its IUPAC name is 2-[[(4-chlorophenyl)-phenylmethyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[(4-chlorophenyl)-phenylmethyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 4858348 |
| Molecular Formula | C21H16ClF3N2O |
| Molecular Weight | 404.82 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-[[(4-chlorophenyl)-phenylmethyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CNC(c1ccccc1)c1ccc(Cl)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H16ClF3N2O/c22-15-8-6-14(7-9-15)21(13-4-2-1-3-5-13)26-12-18(28)27-17-11-10-16(23)19(24)20(17)25/h1-11,21,26H,12H2,(H,27,28) |
| InChIKey | KKTYIEGQBSKNEI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.82 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|