C22H21ClN2O — CID 8545779
2-(benzhydrylamino)-N-[(4-chlorophenyl)methyl]acetamide (PubChem CID 8545779) has the molecular formula C22H21ClN2O and a molecular weight of 364.88 g/mol. Its IUPAC name is 2-(benzhydrylamino)-N-[(4-chlorophenyl)methyl]acetamide.
| Compound Name | 2-(benzhydrylamino)-N-[(4-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8545779 |
| Molecular Formula | C22H21ClN2O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-(benzhydrylamino)-N-[(4-chlorophenyl)methyl]acetamide |
| SMILES | O=C(CNC(c1ccccc1)c1ccccc1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O/c23-20-13-11-17(12-14-20)15-24-21(26)16-25-22(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14,22,25H,15-16H2,(H,24,26) |
| InChIKey | VOHMKUKBMWFABH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |