C21H21ClN2O — CID 9396902
N-[(4-chlorophenyl)methyl]-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide (PubChem CID 9396902) has the molecular formula C21H21ClN2O and a molecular weight of 352.87 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide |
|---|---|
| PubChem CID | 9396902 |
| Molecular Formula | C21H21ClN2O |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide |
| SMILES | C[C@@H](NCC(=O)NCc1ccc(Cl)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H21ClN2O/c1-15(19-8-4-6-17-5-2-3-7-20(17)19)23-14-21(25)24-13-16-9-11-18(22)12-10-16/h2-12,15,23H,13-14H2,1H3,(H,24,25)/t15-/m1/s1 |
| InChIKey | YRCXQWGBKNGQHM-OAHLLOKOSA-N |
| XLogP | 4.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |