C12H15ClN2O3 — CID 83193742
(2R)-2-[[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]amino]propanoic acid (PubChem CID 83193742) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is (2R)-2-[[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 83193742 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2R)-2-[[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]amino]propanoic acid |
| SMILES | C[C@@H](NCC(=O)NCc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C12H15ClN2O3/c1-8(12(17)18)14-7-11(16)15-6-9-2-4-10(13)5-3-9/h2-5,8,14H,6-7H2,1H3,(H,15,16)(H,17,18)/t8-/m1/s1 |
| InChIKey | LXIFUAPOXRPYJB-MRVPVSSYSA-N |
| XLogP | 1.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |