C23H24F2N2O2 — CID 8695568
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide (PubChem CID 8695568) has the molecular formula C23H24F2N2O2 and a molecular weight of 398.45 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide |
|---|---|
| PubChem CID | 8695568 |
| Molecular Formula | C23H24F2N2O2 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide |
| SMILES | C[C@@H](NCC(=O)NCCc1ccc(OC(F)F)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H24F2N2O2/c1-16(20-8-4-6-18-5-2-3-7-21(18)20)27-15-22(28)26-14-13-17-9-11-19(12-10-17)29-23(24)25/h2-12,16,23,27H,13-15H2,1H3,(H,26,28)/t16-/m1/s1 |
| InChIKey | UWDDEVIQBDHOCF-MRXNPFEDSA-N |
| XLogP | 4.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |