C19H21ClF2N2O2 — CID 8637595
2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide (PubChem CID 8637595) has the molecular formula C19H21ClF2N2O2 and a molecular weight of 382.84 g/mol. Its IUPAC name is 2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 8637595 |
| Molecular Formula | C19H21ClF2N2O2 |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide |
| SMILES | C[C@H](NCC(=O)NCCc1ccc(OC(F)F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClF2N2O2/c1-13(15-4-6-16(20)7-5-15)24-12-18(25)23-11-10-14-2-8-17(9-3-14)26-19(21)22/h2-9,13,19,24H,10-12H2,1H3,(H,23,25)/t13-/m0/s1 |
| InChIKey | PIGPANHRZCEYKI-ZDUSSCGKSA-N |
| XLogP | 3.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |