C20H22BrClN2O5 — CID 47006345
2-[1-(4-bromophenyl)ethylamino]-N-[2-(4-chlorophenyl)ethyl]acetamide;oxalic acid (PubChem CID 47006345) has the molecular formula C20H22BrClN2O5 and a molecular weight of 485.76 g/mol. Its IUPAC name is 2-[1-(4-bromophenyl)ethylamino]-N-[2-(4-chlorophenyl)ethyl]acetamide;oxalic acid.
| Compound Name | 2-[1-(4-bromophenyl)ethylamino]-N-[2-(4-chlorophenyl)ethyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 47006345 |
| Molecular Formula | C20H22BrClN2O5 |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 2-[1-(4-bromophenyl)ethylamino]-N-[2-(4-chlorophenyl)ethyl]acetamide;oxalic acid |
| SMILES | CC(NCC(=O)NCCc1ccc(Cl)cc1)c1ccc(Br)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H20BrClN2O.C2H2O4/c1-13(15-4-6-16(19)7-5-15)22-12-18(23)21-11-10-14-2-8-17(20)9-3-14;3-1(4)2(5)6/h2-9,13,22H,10-12H2,1H3,(H,21,23);(H,3,4)(H,5,6) |
| InChIKey | OPUMLGXJDIQSCN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|