C17H15Cl2F2NO2 — CID 18267777
2-(2,4-dichlorophenyl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide (PubChem CID 18267777) has the molecular formula C17H15Cl2F2NO2 and a molecular weight of 374.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 18267777 |
| Molecular Formula | C17H15Cl2F2NO2 |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H15Cl2F2NO2/c18-13-4-3-12(15(19)10-13)9-16(23)22-8-7-11-1-5-14(6-2-11)24-17(20)21/h1-6,10,17H,7-9H2,(H,22,23) |
| InChIKey | BTRIZLQZYFZNFG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |