C16H14Cl3NO — CID 9217667
N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dichlorophenyl)acetamide (PubChem CID 9217667) has the molecular formula C16H14Cl3NO and a molecular weight of 342.65 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dichlorophenyl)acetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 9217667 |
| Molecular Formula | C16H14Cl3NO |
| Molecular Weight | 342.65 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14Cl3NO/c17-13-4-1-11(2-5-13)7-8-20-16(21)9-12-3-6-14(18)10-15(12)19/h1-6,10H,7-9H2,(H,20,21) |
| InChIKey | ODLPRDCJWVBLKR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |