C17H16Cl2N2O3 — CID 47038490
N-[2-[[2-(2,4-dichlorophenyl)acetyl]amino]ethyl]-4-hydroxybenzamide (PubChem CID 47038490) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is N-[2-[[2-(2,4-dichlorophenyl)acetyl]amino]ethyl]-4-hydroxybenzamide.
| Compound Name | N-[2-[[2-(2,4-dichlorophenyl)acetyl]amino]ethyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 47038490 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-[2-[[2-(2,4-dichlorophenyl)acetyl]amino]ethyl]-4-hydroxybenzamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)NCCNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c18-13-4-1-12(15(19)10-13)9-16(23)20-7-8-21-17(24)11-2-5-14(22)6-3-11/h1-6,10,22H,7-9H2,(H,20,23)(H,21,24) |
| InChIKey | CFTRMQBMIPEGOY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|