C18H17Cl2N3O4 — CID 9246410
N-[3-[2-(2,4-dichlorophenyl)ethylamino]-3-oxopropyl]-4-nitrobenzamide (PubChem CID 9246410) has the molecular formula C18H17Cl2N3O4 and a molecular weight of 410.26 g/mol. Its IUPAC name is N-[3-[2-(2,4-dichlorophenyl)ethylamino]-3-oxopropyl]-4-nitrobenzamide.
| Compound Name | N-[3-[2-(2,4-dichlorophenyl)ethylamino]-3-oxopropyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 9246410 |
| Molecular Formula | C18H17Cl2N3O4 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-[3-[2-(2,4-dichlorophenyl)ethylamino]-3-oxopropyl]-4-nitrobenzamide |
| SMILES | O=C(CCNC(=O)c1ccc([N+](=O)[O-])cc1)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O4/c19-14-4-1-12(16(20)11-14)7-9-21-17(24)8-10-22-18(25)13-2-5-15(6-3-13)23(26)27/h1-6,11H,7-10H2,(H,21,24)(H,22,25) |
| InChIKey | HGMLYDCMEIZCEG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|