C18H16Cl2N4O5S — CID 24641172
N-[3-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]-4-nitrobenzamide (PubChem CID 24641172) has the molecular formula C18H16Cl2N4O5S and a molecular weight of 471.32 g/mol. Its IUPAC name is N-[3-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]-4-nitrobenzamide.
| Compound Name | N-[3-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 24641172 |
| Molecular Formula | C18H16Cl2N4O5S |
| Molecular Weight | 471.32 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | N-[3-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]-4-nitrobenzamide |
| SMILES | O=C(CCNC(=O)c1ccc([N+](=O)[O-])cc1)NNC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H16Cl2N4O5S/c19-12-3-6-14(20)15(9-12)30-10-17(26)23-22-16(25)7-8-21-18(27)11-1-4-13(5-2-11)24(28)29/h1-6,9H,7-8,10H2,(H,21,27)(H,22,25)(H,23,26) |
| InChIKey | MVRPATBQMPIVFQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|