C13H17N5O4S — CID 7977380
N-[3-[2-(ethylcarbamothioyl)hydrazinyl]-3-oxopropyl]-4-nitrobenzamide (PubChem CID 7977380) has the molecular formula C13H17N5O4S and a molecular weight of 339.38 g/mol. Its IUPAC name is N-[3-[2-(ethylcarbamothioyl)hydrazinyl]-3-oxopropyl]-4-nitrobenzamide.
| Compound Name | N-[3-[2-(ethylcarbamothioyl)hydrazinyl]-3-oxopropyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 7977380 |
| Molecular Formula | C13H17N5O4S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-[3-[2-(ethylcarbamothioyl)hydrazinyl]-3-oxopropyl]-4-nitrobenzamide |
| SMILES | CCNC(=S)NNC(=O)CCNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H17N5O4S/c1-2-14-13(23)17-16-11(19)7-8-15-12(20)9-3-5-10(6-4-9)18(21)22/h3-6H,2,7-8H2,1H3,(H,15,20)(H,16,19)(H2,14,17,23) |
| InChIKey | PUBGZYWHPBTNHV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|