C10H11N5O5S — CID 155560704
1-[(3,5-dinitrobenzoyl)amino]-3-ethylthiourea (PubChem CID 155560704) has the molecular formula C10H11N5O5S and a molecular weight of 313.30 g/mol. Its IUPAC name is 1-[(3,5-dinitrobenzoyl)amino]-3-ethylthiourea.
| Compound Name | 1-[(3,5-dinitrobenzoyl)amino]-3-ethylthiourea |
|---|---|
| PubChem CID | 155560704 |
| Molecular Formula | C10H11N5O5S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-[(3,5-dinitrobenzoyl)amino]-3-ethylthiourea |
| SMILES | CCNC(=S)NNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11N5O5S/c1-2-11-10(21)13-12-9(16)6-3-7(14(17)18)5-8(4-6)15(19)20/h3-5H,2H2,1H3,(H,12,16)(H2,11,13,21) |
| InChIKey | CTPBDEYTMPLLKX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|