C11H13N5O5S — CID 171395593
1-[(3,5-dinitrobenzoyl)amino]-3-propylthiourea (PubChem CID 171395593) has the molecular formula C11H13N5O5S and a molecular weight of 327.32 g/mol. Its IUPAC name is 1-[(3,5-dinitrobenzoyl)amino]-3-propylthiourea.
| Compound Name | 1-[(3,5-dinitrobenzoyl)amino]-3-propylthiourea |
|---|---|
| PubChem CID | 171395593 |
| Molecular Formula | C11H13N5O5S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 1-[(3,5-dinitrobenzoyl)amino]-3-propylthiourea |
| SMILES | CCCNC(=S)NNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13N5O5S/c1-2-3-12-11(22)14-13-10(17)7-4-8(15(18)19)6-9(5-7)16(20)21/h4-6H,2-3H2,1H3,(H,13,17)(H2,12,14,22) |
| InChIKey | UUZBBOSSNRKNMM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|