C13H17ClN4O3S — CID 9220382
1-[(2-chloro-5-nitrobenzoyl)amino]-3-pentylthiourea (PubChem CID 9220382) has the molecular formula C13H17ClN4O3S and a molecular weight of 344.82 g/mol. Its IUPAC name is 1-[(2-chloro-5-nitrobenzoyl)amino]-3-pentylthiourea.
| Compound Name | 1-[(2-chloro-5-nitrobenzoyl)amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9220382 |
| Molecular Formula | C13H17ClN4O3S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-[(2-chloro-5-nitrobenzoyl)amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C13H17ClN4O3S/c1-2-3-4-7-15-13(22)17-16-12(19)10-8-9(18(20)21)5-6-11(10)14/h5-6,8H,2-4,7H2,1H3,(H,16,19)(H2,15,17,22) |
| InChIKey | PTDBYXWZLDNTLX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|