C12H15Cl2N3OS — CID 40648193
1-butyl-3-[(2,4-dichlorobenzoyl)amino]thiourea (PubChem CID 40648193) has the molecular formula C12H15Cl2N3OS and a molecular weight of 320.25 g/mol. Its IUPAC name is 1-butyl-3-[(2,4-dichlorobenzoyl)amino]thiourea.
| Compound Name | 1-butyl-3-[(2,4-dichlorobenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 40648193 |
| Molecular Formula | C12H15Cl2N3OS |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 1-butyl-3-[(2,4-dichlorobenzoyl)amino]thiourea |
| SMILES | CCCCNC(=S)NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2N3OS/c1-2-3-6-15-12(19)17-16-11(18)9-5-4-8(13)7-10(9)14/h4-5,7H,2-3,6H2,1H3,(H,16,18)(H2,15,17,19) |
| InChIKey | PLUTYALFCHNJTK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|