C8H5Cl2N2OS2- — CID 135747047
N-[(2,4-dichlorobenzoyl)amino]carbamodithioate (PubChem CID 135747047) has the molecular formula C8H5Cl2N2OS2- and a molecular weight of 280.18 g/mol. Its IUPAC name is N-[(2,4-dichlorobenzoyl)amino]carbamodithioate.
| Compound Name | N-[(2,4-dichlorobenzoyl)amino]carbamodithioate |
|---|---|
| PubChem CID | 135747047 |
| Molecular Formula | C8H5Cl2N2OS2- |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 278.92 |
| IUPAC Name | N-[(2,4-dichlorobenzoyl)amino]carbamodithioate |
| SMILES | O=C(NNC(=S)[S-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2N2OS2/c9-4-1-2-5(6(10)3-4)7(13)11-12-8(14)15/h1-3H,(H,11,13)(H2,12,14,15)/p-1 |
| InChIKey | CNRZPOAVBYGDOL-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|