C16H11Cl4N3O3S — CID 3508978
2,4-dichloro-N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]benzamide (PubChem CID 3508978) has the molecular formula C16H11Cl4N3O3S and a molecular weight of 467.16 g/mol. Its IUPAC name is 2,4-dichloro-N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3508978 |
| Molecular Formula | C16H11Cl4N3O3S |
| Molecular Weight | 467.16 g/mol |
| Exact Mass | 464.93 |
| IUPAC Name | 2,4-dichloro-N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]benzamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NNC(=S)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl4N3O3S/c17-8-1-3-10(11(19)5-8)15(25)21-16(27)23-22-14(24)7-26-13-4-2-9(18)6-12(13)20/h1-6H,7H2,(H,22,24)(H2,21,23,25,27) |
| InChIKey | OHIYYLURQXVOCY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.16 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|