C19H18BrCl2N3O4S — CID 17352377
5-bromo-N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]-2-propoxybenzamide (PubChem CID 17352377) has the molecular formula C19H18BrCl2N3O4S and a molecular weight of 535.25 g/mol. Its IUPAC name is 5-bromo-N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]-2-propoxybenzamide.
| Compound Name | 5-bromo-N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]-2-propoxybenzamide |
|---|---|
| PubChem CID | 17352377 |
| Molecular Formula | C19H18BrCl2N3O4S |
| Molecular Weight | 535.25 g/mol |
| Exact Mass | 532.96 |
| IUPAC Name | 5-bromo-N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]-2-propoxybenzamide |
| SMILES | CCCOc1ccc(Br)cc1C(=O)NC(=S)NNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H18BrCl2N3O4S/c1-2-7-28-15-5-3-11(20)8-13(15)18(27)23-19(30)25-24-17(26)10-29-16-6-4-12(21)9-14(16)22/h3-6,8-9H,2,7,10H2,1H3,(H,24,26)(H2,23,25,27,30) |
| InChIKey | JHZDYVOEWXHJAP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|