C19H18Br2ClN3O5S — CID 17357721
5-bromo-N-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 17357721) has the molecular formula C19H18Br2ClN3O5S and a molecular weight of 595.70 g/mol. Its IUPAC name is 5-bromo-N-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | 5-bromo-N-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17357721 |
| Molecular Formula | C19H18Br2ClN3O5S |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 592.90 |
| IUPAC Name | 5-bromo-N-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NC(=S)NNC(=O)COc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C19H18Br2ClN3O5S/c1-28-6-7-29-15-4-2-11(20)8-13(15)18(27)23-19(31)25-24-17(26)10-30-16-5-3-12(21)9-14(16)22/h2-5,8-9H,6-7,10H2,1H3,(H,24,26)(H2,23,25,27,31) |
| InChIKey | YCXGSIUUKHFAOR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|