C16H12BrClFN3O3S — CID 3365573
N-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioyl]-4-fluorobenzamide (PubChem CID 3365573) has the molecular formula C16H12BrClFN3O3S and a molecular weight of 460.71 g/mol. Its IUPAC name is N-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioyl]-4-fluorobenzamide.
| Compound Name | N-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 3365573 |
| Molecular Formula | C16H12BrClFN3O3S |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 458.95 |
| IUPAC Name | N-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioyl]-4-fluorobenzamide |
| SMILES | O=C(COc1ccc(Br)cc1Cl)NNC(=S)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12BrClFN3O3S/c17-10-3-6-13(12(18)7-10)25-8-14(23)21-22-16(26)20-15(24)9-1-4-11(19)5-2-9/h1-7H,8H2,(H,21,23)(H2,20,22,24,26) |
| InChIKey | DDVQWVFALSNPIN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|