C15H11BrClF2N3O2S — CID 2208797
1-[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]-3-(2,4-difluorophenyl)thiourea (PubChem CID 2208797) has the molecular formula C15H11BrClF2N3O2S and a molecular weight of 450.69 g/mol. Its IUPAC name is 1-[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]-3-(2,4-difluorophenyl)thiourea.
| Compound Name | 1-[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]-3-(2,4-difluorophenyl)thiourea |
|---|---|
| PubChem CID | 2208797 |
| Molecular Formula | C15H11BrClF2N3O2S |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 448.94 |
| IUPAC Name | 1-[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]-3-(2,4-difluorophenyl)thiourea |
| SMILES | O=C(COc1ccc(Br)cc1Cl)NNC(=S)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H11BrClF2N3O2S/c16-8-1-4-13(10(17)5-8)24-7-14(23)21-22-15(25)20-12-3-2-9(18)6-11(12)19/h1-6H,7H2,(H,21,23)(H2,20,22,25) |
| InChIKey | SZJDAMBNKXKTAN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|