C19H19BrClN3O4S — CID 3293934
2-(4-bromo-2-chlorophenoxy)-N-[[[2-(4-ethylphenoxy)acetyl]amino]carbamothioyl]acetamide (PubChem CID 3293934) has the molecular formula C19H19BrClN3O4S and a molecular weight of 500.80 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenoxy)-N-[[[2-(4-ethylphenoxy)acetyl]amino]carbamothioyl]acetamide.
| Compound Name | 2-(4-bromo-2-chlorophenoxy)-N-[[[2-(4-ethylphenoxy)acetyl]amino]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3293934 |
| Molecular Formula | C19H19BrClN3O4S |
| Molecular Weight | 500.80 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | 2-(4-bromo-2-chlorophenoxy)-N-[[[2-(4-ethylphenoxy)acetyl]amino]carbamothioyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)NNC(=S)NC(=O)COc2ccc(Br)cc2Cl)cc1 |
| InChI | InChI=1S/C19H19BrClN3O4S/c1-2-12-3-6-14(7-4-12)27-11-18(26)23-24-19(29)22-17(25)10-28-16-8-5-13(20)9-15(16)21/h3-9H,2,10-11H2,1H3,(H,23,26)(H2,22,24,25,29) |
| InChIKey | BZAYRDGAPUTJSI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|