C18H17Br2N3O4S — CID 4505578
2-(2,4-dibromophenoxy)-N-[[[2-(4-methylphenoxy)acetyl]amino]carbamothioyl]acetamide (PubChem CID 4505578) has the molecular formula C18H17Br2N3O4S and a molecular weight of 531.23 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-[[[2-(4-methylphenoxy)acetyl]amino]carbamothioyl]acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-[[[2-(4-methylphenoxy)acetyl]amino]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4505578 |
| Molecular Formula | C18H17Br2N3O4S |
| Molecular Weight | 531.23 g/mol |
| Exact Mass | 528.93 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-[[[2-(4-methylphenoxy)acetyl]amino]carbamothioyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)NNC(=S)NC(=O)COc2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C18H17Br2N3O4S/c1-11-2-5-13(6-3-11)26-10-17(25)22-23-18(28)21-16(24)9-27-15-7-4-12(19)8-14(15)20/h2-8H,9-10H2,1H3,(H,22,25)(H2,21,23,24,28) |
| InChIKey | NDXUMWWPKQOGHF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|