C14H17Br2N3O3S — CID 4927735
N-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioyl]-2,2-dimethylpropanamide (PubChem CID 4927735) has the molecular formula C14H17Br2N3O3S and a molecular weight of 467.18 g/mol. Its IUPAC name is N-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 4927735 |
| Molecular Formula | C14H17Br2N3O3S |
| Molecular Weight | 467.18 g/mol |
| Exact Mass | 464.94 |
| IUPAC Name | N-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC(=S)NNC(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H17Br2N3O3S/c1-14(2,3)12(21)17-13(23)19-18-11(20)7-22-10-5-4-8(15)6-9(10)16/h4-6H,7H2,1-3H3,(H,18,20)(H2,17,19,21,23) |
| InChIKey | PDLWCBCNWKUEQK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|