C13H17Br2N3O2S — CID 26286565
1-tert-butyl-3-[[2-(2,4-dibromophenoxy)acetyl]amino]thiourea (PubChem CID 26286565) has the molecular formula C13H17Br2N3O2S and a molecular weight of 439.17 g/mol. Its IUPAC name is 1-tert-butyl-3-[[2-(2,4-dibromophenoxy)acetyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[2-(2,4-dibromophenoxy)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 26286565 |
| Molecular Formula | C13H17Br2N3O2S |
| Molecular Weight | 439.17 g/mol |
| Exact Mass | 436.94 |
| IUPAC Name | 1-tert-butyl-3-[[2-(2,4-dibromophenoxy)acetyl]amino]thiourea |
| SMILES | CC(C)(C)NC(=S)NNC(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H17Br2N3O2S/c1-13(2,3)16-12(21)18-17-11(19)7-20-10-5-4-8(14)6-9(10)15/h4-6H,7H2,1-3H3,(H,17,19)(H2,16,18,21) |
| InChIKey | LJZBMJCXWYYKJM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|