C16H12Br2IN3O3S — CID 3528834
N-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioyl]-2-iodobenzamide (PubChem CID 3528834) has the molecular formula C16H12Br2IN3O3S and a molecular weight of 613.07 g/mol. Its IUPAC name is N-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioyl]-2-iodobenzamide.
| Compound Name | N-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 3528834 |
| Molecular Formula | C16H12Br2IN3O3S |
| Molecular Weight | 613.07 g/mol |
| Exact Mass | 610.80 |
| IUPAC Name | N-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioyl]-2-iodobenzamide |
| SMILES | O=C(COc1ccc(Br)cc1Br)NNC(=S)NC(=O)c1ccccc1I |
| InChI | InChI=1S/C16H12Br2IN3O3S/c17-9-5-6-13(11(18)7-9)25-8-14(23)21-22-16(26)20-15(24)10-3-1-2-4-12(10)19/h1-7H,8H2,(H,21,23)(H2,20,22,24,26) |
| InChIKey | ZVSXGGCDHQABOS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.07 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|