C21H24BrN3O4S — CID 4922523
N-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioyl]-2-methoxybenzamide (PubChem CID 4922523) has the molecular formula C21H24BrN3O4S and a molecular weight of 494.41 g/mol. Its IUPAC name is N-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioyl]-2-methoxybenzamide.
| Compound Name | N-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4922523 |
| Molecular Formula | C21H24BrN3O4S |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | N-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(=S)NNC(=O)COc1ccc(C(C)(C)C)cc1Br |
| InChI | InChI=1S/C21H24BrN3O4S/c1-21(2,3)13-9-10-17(15(22)11-13)29-12-18(26)24-25-20(30)23-19(27)14-7-5-6-8-16(14)28-4/h5-11H,12H2,1-4H3,(H,24,26)(H2,23,25,27,30) |
| InChIKey | DUKRLWMVZMOPFB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|