C20H28BrN3O6S — CID 17339000
2-methoxyethyl 4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 17339000) has the molecular formula C20H28BrN3O6S and a molecular weight of 518.43 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17339000 |
| Molecular Formula | C20H28BrN3O6S |
| Molecular Weight | 518.43 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 2-methoxyethyl 4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)NNC(=O)COc1ccc(C(C)(C)C)cc1Br |
| InChI | InChI=1S/C20H28BrN3O6S/c1-20(2,3)13-5-6-15(14(21)11-13)30-12-17(26)23-24-19(31)22-16(25)7-8-18(27)29-10-9-28-4/h5-6,11H,7-10,12H2,1-4H3,(H,23,26)(H2,22,24,25,31) |
| InChIKey | BSQRUIYCXLUBPQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|