C17H22BrN3O5S — CID 4933738
propyl 4-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 4933738) has the molecular formula C17H22BrN3O5S and a molecular weight of 460.35 g/mol. Its IUPAC name is propyl 4-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | propyl 4-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4933738 |
| Molecular Formula | C17H22BrN3O5S |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | propyl 4-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCCOC(=O)CCC(=O)NC(=S)NNC(=O)COc1ccc(C)cc1Br |
| InChI | InChI=1S/C17H22BrN3O5S/c1-3-8-25-16(24)7-6-14(22)19-17(27)21-20-15(23)10-26-13-5-4-11(2)9-12(13)18/h4-5,9H,3,6-8,10H2,1-2H3,(H,20,23)(H2,19,21,22,27) |
| InChIKey | ISWFCBPVWGLLER-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|