C17H23N3O5S — CID 4933696
propyl 4-[[[2-(2-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 4933696) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is propyl 4-[[[2-(2-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | propyl 4-[[[2-(2-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4933696 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | propyl 4-[[[2-(2-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCCOC(=O)CCC(=O)NC(=S)NNC(=O)COc1ccccc1C |
| InChI | InChI=1S/C17H23N3O5S/c1-3-10-24-16(23)9-8-14(21)18-17(26)20-19-15(22)11-25-13-7-5-4-6-12(13)2/h4-7H,3,8-11H2,1-2H3,(H,19,22)(H2,18,20,21,26) |
| InChIKey | XSOYLMPUBIQRSK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|