C16H21N3O5S — CID 17344028
methyl 4-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 17344028) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is methyl 4-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17344028 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | methyl 4-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)NC(=S)NNC(=O)COc1cccc(C)c1C |
| InChI | InChI=1S/C16H21N3O5S/c1-10-5-4-6-12(11(10)2)24-9-14(21)18-19-16(25)17-13(20)7-8-15(22)23-3/h4-6H,7-9H2,1-3H3,(H,18,21)(H2,17,19,20,25) |
| InChIKey | QHMZKNWPCQUDIX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|