C11H15NO3 — CID 60717689
2-(2,3-dimethylphenoxy)-N-methoxyacetamide (PubChem CID 60717689) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-methoxyacetamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-methoxyacetamide |
|---|---|
| PubChem CID | 60717689 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-methoxyacetamide |
| SMILES | CONC(=O)COc1cccc(C)c1C |
| InChI | InChI=1S/C11H15NO3/c1-8-5-4-6-10(9(8)2)15-7-11(13)12-14-3/h4-6H,7H2,1-3H3,(H,12,13) |
| InChIKey | KYSTUXJIYAUKCH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|