C15H23NO2 — CID 50945244
2-(2,3-dimethylphenoxy)-N-pentan-2-ylacetamide (PubChem CID 50945244) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-pentan-2-ylacetamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-pentan-2-ylacetamide |
|---|---|
| PubChem CID | 50945244 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-pentan-2-ylacetamide |
| SMILES | CCCC(C)NC(=O)COc1cccc(C)c1C |
| InChI | InChI=1S/C15H23NO2/c1-5-7-12(3)16-15(17)10-18-14-9-6-8-11(2)13(14)4/h6,8-9,12H,5,7,10H2,1-4H3,(H,16,17) |
| InChIKey | CHJGQYHAUPDIST-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |