C13H16NO4- — CID 9156871
(2S)-2-[[2-(2,3-dimethylphenoxy)acetyl]amino]propanoate (PubChem CID 9156871) has the molecular formula C13H16NO4- and a molecular weight of 250.27 g/mol. Its IUPAC name is (2S)-2-[[2-(2,3-dimethylphenoxy)acetyl]amino]propanoate.
| Compound Name | (2S)-2-[[2-(2,3-dimethylphenoxy)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 9156871 |
| Molecular Formula | C13H16NO4- |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2S)-2-[[2-(2,3-dimethylphenoxy)acetyl]amino]propanoate |
| SMILES | Cc1cccc(OCC(=O)N[C@@H](C)C(=O)[O-])c1C |
| InChI | InChI=1S/C13H17NO4/c1-8-5-4-6-11(9(8)2)18-7-12(15)14-10(3)13(16)17/h4-6,10H,7H2,1-3H3,(H,14,15)(H,16,17)/p-1/t10-/m0/s1 |
| InChIKey | NAFCUMJNWSVIJL-JTQLQIEISA-M |
| XLogP | -0.06 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |