C21H23BrN2O5 — CID 4947014
2-phenylethyl 4-[2-[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinyl]-4-oxobutanoate (PubChem CID 4947014) has the molecular formula C21H23BrN2O5 and a molecular weight of 463.33 g/mol. Its IUPAC name is 2-phenylethyl 4-[2-[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinyl]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[2-[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 4947014 |
| Molecular Formula | C21H23BrN2O5 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 2-phenylethyl 4-[2-[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinyl]-4-oxobutanoate |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)CCC(=O)OCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C21H23BrN2O5/c1-15-7-8-18(17(22)13-15)29-14-20(26)24-23-19(25)9-10-21(27)28-12-11-16-5-3-2-4-6-16/h2-8,13H,9-12,14H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | ZPMWENSRVVFCHC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|