C20H22N2O4 — CID 4946923
2-phenylethyl 4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobutanoate (PubChem CID 4946923) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-phenylethyl 4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 4946923 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-phenylethyl 4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobutanoate |
| SMILES | Cc1cccc(C(=O)NNC(=O)CCC(=O)OCCc2ccccc2)c1 |
| InChI | InChI=1S/C20H22N2O4/c1-15-6-5-9-17(14-15)20(25)22-21-18(23)10-11-19(24)26-13-12-16-7-3-2-4-8-16/h2-9,14H,10-13H2,1H3,(H,21,23)(H,22,25) |
| InChIKey | VYGOPKYUUVIMGH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|