C25H30N4O5S — CID 4947565
2-phenylethyl 4-[[[4-(3,4-dimethylanilino)-4-oxobutanoyl]amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 4947565) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is 2-phenylethyl 4-[[[4-(3,4-dimethylanilino)-4-oxobutanoyl]amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[[[4-(3,4-dimethylanilino)-4-oxobutanoyl]amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4947565 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-phenylethyl 4-[[[4-(3,4-dimethylanilino)-4-oxobutanoyl]amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | Cc1ccc(NC(=O)CCC(=O)NNC(=S)NC(=O)CCC(=O)OCCc2ccccc2)cc1C |
| InChI | InChI=1S/C25H30N4O5S/c1-17-8-9-20(16-18(17)2)26-21(30)10-11-23(32)28-29-25(35)27-22(31)12-13-24(33)34-15-14-19-6-4-3-5-7-19/h3-9,16H,10-15H2,1-2H3,(H,26,30)(H,28,32)(H2,27,29,31,35) |
| InChIKey | YOQNXRXGVPHZDX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|