C19H21N3O5S2 — CID 4947177
2-phenylethyl 4-oxo-4-[(4-sulfamoylphenyl)carbamothioylamino]butanoate (PubChem CID 4947177) has the molecular formula C19H21N3O5S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-phenylethyl 4-oxo-4-[(4-sulfamoylphenyl)carbamothioylamino]butanoate.
| Compound Name | 2-phenylethyl 4-oxo-4-[(4-sulfamoylphenyl)carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 4947177 |
| Molecular Formula | C19H21N3O5S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-phenylethyl 4-oxo-4-[(4-sulfamoylphenyl)carbamothioylamino]butanoate |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NC(=O)CCC(=O)OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H21N3O5S2/c20-29(25,26)16-8-6-15(7-9-16)21-19(28)22-17(23)10-11-18(24)27-13-12-14-4-2-1-3-5-14/h1-9H,10-13H2,(H2,20,25,26)(H2,21,22,23,28) |
| InChIKey | UQMLBDWGLJYHOB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|