C28H31N3O5S2 — CID 4934609
3-phenylpropyl 4-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 4934609) has the molecular formula C28H31N3O5S2 and a molecular weight of 553.71 g/mol. Its IUPAC name is 3-phenylpropyl 4-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 3-phenylpropyl 4-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4934609 |
| Molecular Formula | C28H31N3O5S2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 3-phenylpropyl 4-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(NC(=S)NC(=O)CCC(=O)OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H31N3O5S2/c1-31(21-23-11-6-3-7-12-23)38(34,35)25-16-14-24(15-17-25)29-28(37)30-26(32)18-19-27(33)36-20-8-13-22-9-4-2-5-10-22/h2-7,9-12,14-17H,8,13,18-21H2,1H3,(H2,29,30,32,37) |
| InChIKey | VZMNFBVJIAWRAC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|